DL-9-Anthrylalanine structure
|
Common Name | DL-9-Anthrylalanine | ||
|---|---|---|---|---|
| CAS Number | 76932-40-6 | Molecular Weight | 265.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | DL-9-Anthrylalanine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO2 |
|---|---|
| Molecular Weight | 265.30700 |
| Exact Mass | 265.11000 |
| PSA | 63.32000 |
| LogP | 3.64770 |
| InChIKey | MRVJUNXMEDRMRO-UHFFFAOYSA-N |
| SMILES | NC(Cc1c2ccccc2cc2ccccc12)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
DL-9-Anthrylalanine CAS#:76932-40-6 |
| Literature: Schreiber,W.; Lautsch,W. Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1965 , vol. 340, p. 95 - 96 |
|
~%
DL-9-Anthrylalanine CAS#:76932-40-6 |
| Literature: Schreiber,W.; Lautsch,W. Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1965 , vol. 340, p. 95 - 96 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 9,12-Octadecadienoic acid (9Z,12Z)-,(2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-(4R,8R)-4,8,12-trimethyltridecyl-2H-1-benzopyran-6-yl ester,rel |
| 2,5,7,8-Tetramethyl-2-(4,8,12-trimethyltridecyl)-6-(linoleoyloxy)chroman |
| 12-Octadecadienoic acid (Z,Z)-,3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-1-b9 |
| VITAMIN E LINOLEATE |
| (9Z,12Z)-9,12-Octadecadienoic acid 2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-1-benzopyran-6-yl ester |
| (9Z,12Z)-9,12-Octadecadienoic acid 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-2H-1-benzopyran-6-yl ester |