2,4,6-Trimethylphenylalanine structure
|
Common Name | 2,4,6-Trimethylphenylalanine | ||
|---|---|---|---|---|
| CAS Number | 76932-42-8 | Molecular Weight | 207.269 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 357.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8±24.6 °C | |
| Name | 2-amino-3-(2,4,6-trimethylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.2±30.0 °C at 760 mmHg |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.269 |
| Flash Point | 169.8±24.6 °C |
| Exact Mass | 207.125931 |
| PSA | 63.32000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | CRNOZLNQYAUXRK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(CC(N)C(=O)O)c(C)c1 |
| HS Code | 2922499990 |
|---|
|
~88%
2,4,6-Trimethyl... CAS#:76932-42-8 |
| Literature: Nestor Jr.; Ho; Simpson; Horner; Jones; McRae; Vickery Journal of Medicinal Chemistry, 1982 , vol. 25, # 7 p. 795 - 801 |
|
~%
2,4,6-Trimethyl... CAS#:76932-42-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 7 p. 795 - 801 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-AMINO-3-MESITYLPROPANOIC ACID |
| 2,4,6-Trimethyl-DL-phenylalanine |
| Phenylalanine, 2,4,6-trimethyl- |
| 2,4,6-Trimethylphenylalanine |
| 2,4,6-trimethyl-phenylalanine |
| 2,3-DIHYDRO-5-NITRO-(1H)-INDOLE |