1-(2-bromo-1,1,1-trifluoropropan-2-yl)-4-methylbenzene structure
|
Common Name | 1-(2-bromo-1,1,1-trifluoropropan-2-yl)-4-methylbenzene | ||
|---|---|---|---|---|
| CAS Number | 76954-05-7 | Molecular Weight | 267.08600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrF3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-bromo-1,1,1-trifluoropropan-2-yl)-4-methylbenzene |
|---|
| Molecular Formula | C10H10BrF3 |
|---|---|
| Molecular Weight | 267.08600 |
| Exact Mass | 265.99200 |
| LogP | 4.16740 |
| InChIKey | JTDHRYVTKNVIJV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)(Br)C(F)(F)F)cc1 |
|
~83%
1-(2-bromo-1,1,... CAS#:76954-05-7 |
| Literature: Liu, Kwang-Ting; Kuo, Mann-Yan; Shu, Ching-Fen Journal of the American Chemical Society, 1982 , vol. 104, # 1 p. 211 - 215 |
|
~%
1-(2-bromo-1,1,... CAS#:76954-05-7 |
| Literature: Liu, Kwang-Ting; Kuo, Mann-Yan; Shu, Ching-Fen Journal of the American Chemical Society, 1982 , vol. 104, # 1 p. 211 - 215 |
|
~%
1-(2-bromo-1,1,... CAS#:76954-05-7 |
| Literature: Liu, Kwang-Ting; Sheu, Ching-Fen Tetrahedron Letters, 1980 , vol. 21, p. 4091 - 4094 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |