Riboflavin 5a(2)-(trihydrogen diphosphate), 7-demethyl-7-ethyl-, Pa(2)a5a(2)-ester with adenosine structure
|
Common Name | Riboflavin 5a(2)-(trihydrogen diphosphate), 7-demethyl-7-ethyl-, Pa(2)a5a(2)-ester with adenosine | ||
|---|---|---|---|---|
| CAS Number | 76959-14-3 | Molecular Weight | 799.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H35N9O15P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Riboflavin 5a(2)-(trihydrogen diphosphate), 7-demethyl-7-ethyl-, Pa(2)a5a(2)-ester with adenosine |
|---|
| Molecular Formula | C28H35N9O15P2 |
|---|---|
| Molecular Weight | 799.6 |
| InChIKey | WSKHAZOPAOSWSY-MZWSMYJRSA-N |
| SMILES | CCc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(O)COP(=O)(O)OP(=O)(O)OCC3OC(n4cnc5c(N)ncnc54)C(O)C3O)c2cc1C |