Aceticacid, 2-(2-chloro-2-propen-1-yl)-2-(phenylmethyl)hydrazide structure
|
Common Name | Aceticacid, 2-(2-chloro-2-propen-1-yl)-2-(phenylmethyl)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 7696-79-9 | Molecular Weight | 238.71300 | |
| Density | 1.149g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-benzyl-N'-(2-chloroallyl)acetohydrazide |
|---|
| Density | 1.149g/cm3 |
|---|---|
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.71300 |
| Exact Mass | 238.08700 |
| PSA | 32.34000 |
| LogP | 2.68310 |
| Index of Refraction | 1.549 |
| InChIKey | UQBMBFPOJFFWDO-UHFFFAOYSA-N |
| SMILES | C=C(Cl)CN(Cc1ccccc1)NC(C)=O |
|
~%
Aceticacid, 2-(... CAS#:7696-79-9 |
| Literature: Gillis; Kadunce The Journal of organic chemistry, 1967 , vol. 32, # 1 p. 91 - 94 |
|
~%
Aceticacid, 2-(... CAS#:7696-79-9 |
| Literature: Gillis; Kadunce The Journal of organic chemistry, 1967 , vol. 32, # 1 p. 91 - 94 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |