N-(2-chloroprop-2-enyl)-N-propan-2-yl-benzohydrazide structure
|
Common Name | N-(2-chloroprop-2-enyl)-N-propan-2-yl-benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 7696-80-2 | Molecular Weight | 252.74000 | |
| Density | 1.117g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzoyl-1-propyl-1H-2-thianaphthalene |
|---|
| Density | 1.117g/cm3 |
|---|---|
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74000 |
| Exact Mass | 252.10300 |
| PSA | 32.34000 |
| LogP | 3.18520 |
| Index of Refraction | 1.541 |
| InChIKey | WFSUDOYMCXSRIS-UHFFFAOYSA-N |
| SMILES | C=C(Cl)CN(NC(=O)c1ccccc1)C(C)C |
|
~%
N-(2-chloroprop... CAS#:7696-80-2 |
| Literature: Gillis; Kadunce The Journal of organic chemistry, 1967 , vol. 32, # 1 p. 91 - 94 |
|
~%
N-(2-chloroprop... CAS#:7696-80-2 |
| Literature: Gillis; Kadunce The Journal of organic chemistry, 1967 , vol. 32, # 1 p. 91 - 94 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |