Alanine,N-carboxy-3-[(carboxymethyl)dithio]-, N-benzyl 3-methyl ester, L- (8CI) structure
|
Common Name | Alanine,N-carboxy-3-[(carboxymethyl)dithio]-, N-benzyl 3-methyl ester, L- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 7697-00-9 | Molecular Weight | 359.41800 | |
| Density | 1.382g/cm3 | Boiling Point | 547.4ºC at 760 mmHg | |
| Molecular Formula | C14H17NO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.9ºC | |
| Name | 1-Carboxy-5-methoxycarbonyl-1-benzyloxycarbonylamino-3,4-dithiopentan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.382g/cm3 |
|---|---|
| Boiling Point | 547.4ºC at 760 mmHg |
| Molecular Formula | C14H17NO6S2 |
| Molecular Weight | 359.41800 |
| Flash Point | 284.9ºC |
| Exact Mass | 359.05000 |
| PSA | 152.53000 |
| LogP | 2.31130 |
| Index of Refraction | 1.594 |
| InChIKey | IJVAOMFVYUGMSN-UHFFFAOYSA-N |
| SMILES | COC(=O)CSSCC(NC(=O)OCc1ccccc1)C(=O)O |
|
~%
Alanine,N-carbo... CAS#:7697-00-9 |
| Literature: Hiskey; Mizoguchi; Smithwick Jr. The Journal of organic chemistry, 1967 , vol. 32, # 1 p. 97 - 102 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| S-(2-bromo-5-fluorophenyl)dimethylthiocarbamate |
| S-(2-Carbomethoxymethylthio)-N-carbobenzoxy-L-cystein |
| Carbamothioic acid,dimethyl-,S-(2-bromo-5-fluorophenyl) ester |
| S-(2-Bromo-5-fluorophenyl)-N,N-dimethyl-thiocarbamate |