2-(3-benzoylphenoxy)-1-piperidin-1-ylpropan-1-one structure
|
Common Name | 2-(3-benzoylphenoxy)-1-piperidin-1-ylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 76981-47-0 | Molecular Weight | 337.41200 | |
| Density | 1.154g/cm3 | Boiling Point | 538.9ºC at 760 mmHg | |
| Molecular Formula | C21H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.7ºC | |
| Name | 2-(3-benzoylphenoxy)-1-piperidin-1-ylpropan-1-one |
|---|
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 538.9ºC at 760 mmHg |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.41200 |
| Flash Point | 279.7ºC |
| Exact Mass | 337.16800 |
| PSA | 46.61000 |
| LogP | 3.63530 |
| Index of Refraction | 1.574 |
| InChIKey | QMNOZJIYDNZIST-UHFFFAOYSA-N |
| SMILES | CC(Oc1cccc(C(=O)c2ccccc2)c1)C(=O)N1CCCCC1 |
|
~71%
2-(3-benzoylphe... CAS#:76981-47-0 |
| Literature: Astoin; Lepage; Fromantin European Journal of Medicinal Chemistry, 1980 , vol. 15, # 5 p. 457 - 462 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |