2-Amino-3-(4-biphenylyl)propanoic acid structure
|
Common Name | 2-Amino-3-(4-biphenylyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 76985-08-5 | Molecular Weight | 241.285 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 428.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.0±27.3 °C | |
| Name | 2-amino-3-(4-phenylphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.6±40.0 °C at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.285 |
| Flash Point | 213.0±27.3 °C |
| Exact Mass | 241.110275 |
| PSA | 63.32000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | JCZLABDVDPYLRZ-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~%
2-Amino-3-(4-bi... CAS#:76985-08-5 |
| Literature: Monatshefte fuer Chemie, , vol. 86, p. 233,246 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-Phenyl-L-phenyalanine |
| 4-Phenyl-DL-Phenylalanine |
| 2-Amino-3-(biphenyl-4-yl)propanoic acid (non-preferred name) |
| 2-Amino-3-(biphenyl-4-yl)propanoic acid |
| 2-AMINO-3-BIPHENYL-4-YL-PROPIONIC ACID |
| 2-Amino-3-(4-biphenylyl)propanoic acid |
| L-4-biphenylalanine |
| p-phenylphenylalanine |
| 2-Amino-3-biphenyl-4-yl-propionsaeure |
| DL-4-PHENYL-PHE-OH |
| DL-BIPHENYLALANINE |
| 4-Phenyl-D-phenyalanine |
| 4'-biphenylalanine |