1-Boc-3-(4-Bromophenyl)piperidine structure
|
Common Name | 1-Boc-3-(4-Bromophenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 769944-73-2 | Molecular Weight | 340.255 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 398.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H22BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.8±27.9 °C | |
| Name | 1-Boc-3-(4-Bromophenyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.5±42.0 °C at 760 mmHg |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.255 |
| Flash Point | 194.8±27.9 °C |
| Exact Mass | 339.083374 |
| PSA | 29.54000 |
| LogP | 4.39 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | WRSHWNCUNYWQBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2ccc(Br)cc2)C1 |
| HS Code | 2933399090 |
|---|
|
~99%
1-Boc-3-(4-Brom... CAS#:769944-73-2 |
| Literature: MITSUBISHI PHARMA CORPORATION; SANOFI-SYNTHELABO Patent: WO2004/85408 A1, 2004 ; Location in patent: Page 289-290 ; WO 2004/085408 A1 |
|
~%
1-Boc-3-(4-Brom... CAS#:769944-73-2 |
| Literature: WO2011/123419 A1, ; WO 2011/123419 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 3-(4-bromophenyl)piperidine-1-carboxylate |
| 1-Piperidinecarboxylic acid, 3-(4-bromophenyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3-(4-bromophenyl)-1-piperidinecarboxylate |