benzothiazole-2(3H)-thione, compound with 2,2',2''-nitrilotris[ethanol] (1:1) structure
|
Common Name | benzothiazole-2(3H)-thione, compound with 2,2',2''-nitrilotris[ethanol] (1:1) | ||
|---|---|---|---|---|
| CAS Number | 76995-02-3 | Molecular Weight | 316.44000 | |
| Density | N/A | Boiling Point | 559.1ºC at 760 mmHg | |
| Molecular Formula | C13H20N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.9ºC | |
| Name | 3H-1,3-benzothiazole-2-thione,2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 559.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.44000 |
| Flash Point | 291.9ºC |
| Exact Mass | 316.09200 |
| PSA | 143.86000 |
| LogP | 0.85030 |
| InChIKey | QQAAXUSDJLLEOS-UHFFFAOYSA-N |
| SMILES | OCCN(CCO)CCO.S=c1[nH]c2ccccc2s1 |
| einecs 278-586-4 |