acetyl carbromal structure
|
Common Name | acetyl carbromal | ||
|---|---|---|---|---|
| CAS Number | 77-66-7 | Molecular Weight | 279.13100 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H15BrN2O3 | Melting Point | 108-109° | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(acetylcarbamoyl)-2-bromo-2-ethylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Melting Point | 108-109° |
| Molecular Formula | C9H15BrN2O3 |
| Molecular Weight | 279.13100 |
| Exact Mass | 278.02700 |
| PSA | 75.27000 |
| LogP | 2.09420 |
| Index of Refraction | 1.5 |
| InChIKey | SAZUGELZHZOXHB-UHFFFAOYSA-N |
| SMILES | CCC(Br)(CC)C(=O)NC(=O)NC(C)=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
acetyl carbromal CAS#:77-66-7 |
| Literature: Bayer and Co. Patent: DE327129 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 809 |
|
~%
acetyl carbromal CAS#:77-66-7 |
| Literature: Bayer and Co. Patent: DE286760 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 704 |
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: ULK1_INH_LUMI_1536_1X%INH PRUN
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| Paxarel |
| Acecarbromal |
| Acetcarbromal |
| Darolon |
| Acetylcarbromal |
| Carbased |
| Acetyladalin |
| Abasin |
| Ibatran |
| Acetcarbromalum |
| N-Acetyl-N'-bromdiaethylacetyl-harnstoff |
| Acetkarbromal |