5-Nitro-3-Furancarboxylic Acid
5-Nitro-3-Furancarboxylic Acid structure
|
Common Name | 5-Nitro-3-Furancarboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 770-07-0 | Molecular Weight | 157.08100 | |
| Density | 1.626g/cm3 | Boiling Point | 329.895ºC at 760 mmHg | |
| Molecular Formula | C5H3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.315ºC | |
Summary: 5-硝基-3-糠酸 (5-nitrofuran-3-carboxylic acid), CAS号 770-07-0, molecular formula C5H3NO5, molecular weight 157.08100. The boiling point is 329.895ºC, and the density is 1.626g/cm³. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-nitrofuran-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.626g/cm3 |
|---|---|
| Boiling Point | 329.895ºC at 760 mmHg |
| Molecular Formula | C5H3NO5 |
| Molecular Weight | 157.08100 |
| Flash Point | 153.315ºC |
| Exact Mass | 157.00100 |
| PSA | 96.26000 |
| LogP | 1.40920 |
| Index of Refraction | 1.577 |
| InChIKey | RYJMQGMUCNUWMK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1coc([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-NITRO-3-FURANCARBOXYLIC ACID |
| FUR004 |
| 5-nitro-furan-3-carboxylic acid |
| 3-Furancarboxylic acid,5-nitro |
| 5-Nitro-furan-3-carbonsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-nitrofuran-3-carboxylic acid? |
| A: The English name of 5-nitrofuran-3-carboxylic acid is 5-nitrofuran-3-carboxylic acid. |
| Q: What is the boiling point of 5-nitrofuran-3-carboxylic acid? |
| A: Boiling point of 5-nitrofuran-3-carboxylic acid is 329.895ºC at 760 mmHg. |
| Q: What is the molecular formula of 5-nitrofuran-3-carboxylic acid? |
| A: Molecular formula of 5-nitrofuran-3-carboxylic acid is C5H3NO5. |
| Q: What is the InChIKey of 5-nitrofuran-3-carboxylic acid? |
| A: InChIKey of 5-nitrofuran-3-carboxylic acid is RYJMQGMUCNUWMK-UHFFFAOYSA-N. |
| Q: What is the LogP of 5-nitrofuran-3-carboxylic acid? |
| A: LogP of 5-nitrofuran-3-carboxylic acid is 1.40920. |
| Q: What is the SMILES notation of 5-nitrofuran-3-carboxylic acid? |
| A: SMILES notation of 5-nitrofuran-3-carboxylic acid is O=C(O)c1coc([N+](=O)[O-])c1. |
| Q: What are the upstream materials of 5-nitrofuran-3-carboxylic acid? |
| A: Related upstream materials(CAS) of 5-nitrofuran-3-carboxylic acid: 488-93-7;4282-28-4;6132-33-8;52900-79-5;858246-05-6;26214-65-3;614-98-2. |
| Q: What is the polar surface area (PSA) of 5-nitrofuran-3-carboxylic acid? |
| A: Polar surface area (PSA) of 5-nitrofuran-3-carboxylic acid is 96.26000. |
| Q: What is the CAS number of 5-nitrofuran-3-carboxylic acid? |
| A: CAS number of 5-nitrofuran-3-carboxylic acid is 770-07-0. |
| Q: What is the molecular weight of 5-nitrofuran-3-carboxylic acid? |
| A: Molecular weight of 5-nitrofuran-3-carboxylic acid is 157.08100. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |