2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide
![2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide Structure](https://image.chemsrc.com/caspic/453/77006-45-2.png)
2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide structure
|
Common Name | 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 77006-45-2 | Molecular Weight | 359.28300 | |
| Density | N/A | Boiling Point | 451.3ºC at 760 mmHg | |
| Molecular Formula | C17H15BrN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 451.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H15BrN2S |
| Molecular Weight | 359.28300 |
| Flash Point | 226.7ºC |
| Exact Mass | 358.01400 |
| PSA | 45.53000 |
| LogP | 4.19160 |
| InChIKey | JAEDJTUWINYJNF-UHFFFAOYSA-N |
| SMILES | Br.c1ccc(C2=C(c3ccccc3)N3CCN=C3S2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~50%
2,3-diphenyl-5,... CAS#:77006-45-2 |
| Literature: Powers, Larry J.; Fogt, S. W.; Ariyan, Z. S.; Rippin, D. J.; Heilman, R. D.; Matthews, Richard J. Journal of Medicinal Chemistry, 1981 , vol. 24, # 5 p. 604 - 609 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole hydrobromide |
| Imidazo(2,1-b)thiazole,5,6-dihydro-2,3-diphenyl-,hydrobromide |
| 2,3-Diphenyl-5,6-dihydroimidazo(2,1-b)thiazole hydrobromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: Molecular weight of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is 359.28300. |
| Q: What is the CAS number of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: CAS number of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is 77006-45-2. |
| Q: What is the SMILES notation of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: SMILES notation of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is Br.c1ccc(C2=C(c3ccccc3)N3CCN=C3S2)cc1. |
| Q: What is the InChIKey of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: InChIKey of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is JAEDJTUWINYJNF-UHFFFAOYSA-N. |
| Q: What is the boiling point of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: Boiling point of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is 451.3ºC at 760 mmHg. |
| Q: What is the English name of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: The English name of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide. |
| Q: What is the Chinese name of 77006-45-2? |
| A: Chinese name of 77006-45-2 is 77006-45-2. |
| Q: What is the LogP of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: LogP of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is 4.19160. |
| Q: What is the polar surface area (PSA) of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: Polar surface area (PSA) of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is 45.53000. |
| Q: What is the molecular formula of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide? |
| A: Molecular formula of 2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole,hydrobromide is C17H15BrN2S. |