(1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid
Modify Date: 2025-11-26 10:00:53
(1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid structure
|
Common Name | (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 77053-79-3 | Molecular Weight | 224.18500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9FO4 |
|---|---|
| Molecular Weight | 224.18500 |
| Exact Mass | 224.04800 |
| PSA | 74.60000 |
| LogP | 1.25260 |
| InChIKey | IFOKEJNJQTYCEI-GZMMTYOYSA-N |
| SMILES | O=C(O)C1CC1(C(=O)O)c1ccc(F)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![1-(4-fluorophenyl)-3-azabicyclo[3.1.0]hexane structure](https://image.chemsrc.com/caspic/469/86215-41-0.png)
CAS#:86215-41-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: InChIKey of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid is IFOKEJNJQTYCEI-GZMMTYOYSA-N. |
| Q: What is the polar surface area (PSA) of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: Polar surface area (PSA) of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid is 74.60000. |
| Q: What is the Chinese name of 77053-79-3? |
| A: Chinese name of 77053-79-3 is 77053-79-3. |
| Q: What is the molecular weight of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: Molecular weight of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid is 224.18500. |
| Q: What are the downstream products of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: Related downstream products(CAS) of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid: 86215-41-0. |
| Q: What is the molecular formula of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: Molecular formula of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid is C11H9FO4. |
| Q: What is the English name of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: The English name of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid is (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid. |
| Q: What is the SMILES notation of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: SMILES notation of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid is O=C(O)C1CC1(C(=O)O)c1ccc(F)cc1. |
| Q: What is the CAS number of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: CAS number of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid is 77053-79-3. |
| Q: What is the LogP of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid? |
| A: LogP of (1R,2S)-1-(4-fluorophenyl)cyclopropane-1,2-dicarboxylic acid is 1.25260. |