methylprednisolone 17-hemisuccinate structure
|
Common Name | methylprednisolone 17-hemisuccinate | ||
|---|---|---|---|---|
| CAS Number | 77074-42-1 | Molecular Weight | 474.54300 | |
| Density | 1.33g/cm3 | Boiling Point | 679.6ºC at 760 mmHg | |
| Molecular Formula | C26H34O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.9ºC | |
| Name | 4-[[(6S,8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]oxy]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 679.6ºC at 760 mmHg |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.54300 |
| Flash Point | 226.9ºC |
| Exact Mass | 474.22500 |
| PSA | 138.20000 |
| LogP | 2.21930 |
| Index of Refraction | 1.593 |
| InChIKey | VDJNUHGXSJAWMH-XYMSELFBSA-N |
| SMILES | CC1CC2C(C(O)CC3(C)C2CCC3(OC(=O)CCC(=O)O)C(=O)CO)C2(C)C=CC(=O)C=C12 |
|
~%
methylprednisol... CAS#:77074-42-1 |
| Literature: Anderson; Conradi; Johnson Journal of Pharmaceutical Sciences, 1983 , vol. 72, # 4 p. 448 - 454 |
|
~%
methylprednisol... CAS#:77074-42-1 |
| Literature: Anderson; Conradi; Lambert Journal of Pharmaceutical Sciences, 1984 , vol. 73, # 5 p. 604 - 610 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 17,21-Dihydroxy-6|A-methylpregna-1,4-diene-3,11,20-trione 21-Acetate |
| 6alpha-Methylprednisone 21-Acetate |
| 6|A-Methyl Prednisone 21-Acetate |