3-Chloro-4-(1-piperidin-4-ylmethyl-piperidin-4-yloxy)benzonitrile
Modify Date: 2025-08-25 17:34:43
3-Chloro-4-(1-piperidin-4-ylmethyl-piperidin-4-yloxy)benzonitrile structure
|
Common Name | 3-Chloro-4-(1-piperidin-4-ylmethyl-piperidin-4-yloxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 770741-07-6 | Molecular Weight | 333.85600 | |
| Density | 1.215g/cm3 | Boiling Point | 474.91ºC at 760 mmHg | |
| Molecular Formula | C18H24ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.017ºC | |
| Name | 3-chloro-4-[1-(piperidin-4-ylmethyl)piperidin-4-yl]oxybenzonitrile |
|---|
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 474.91ºC at 760 mmHg |
| Molecular Formula | C18H24ClN3O |
| Molecular Weight | 333.85600 |
| Flash Point | 241.017ºC |
| Exact Mass | 333.16100 |
| PSA | 48.29000 |
| LogP | 3.32118 |
| Index of Refraction | 1.586 |
| InChIKey | FLCDYCJUBOVFRA-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(OC2CCN(CC3CCNCC3)CC2)c(Cl)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |