3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide
![3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide Structure](https://image.chemsrc.com/caspic/450/77085-33-7.png)
3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide structure
|
Common Name | 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide | ||
|---|---|---|---|---|
| CAS Number | 77085-33-7 | Molecular Weight | 307.24200 | |
| Density | 1.94g/cm3 | Boiling Point | 655.3ºC at 760 mmHg | |
| Molecular Formula | C10H5N5O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.1ºC | |
Summary: 3,7-Dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide (CAS number: 77085-33-7, molecular formula: C10H5N5O5S, molecular weight: 307.24200), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.94g/cm3 |
|---|---|
| Boiling Point | 655.3ºC at 760 mmHg |
| Molecular Formula | C10H5N5O5S |
| Molecular Weight | 307.24200 |
| Flash Point | 350.1ºC |
| Exact Mass | 307.00100 |
| PSA | 165.73000 |
| LogP | 3.56680 |
| Index of Refraction | 1.834 |
| InChIKey | PADQAUGDLBXWOT-OAQYLSRUSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)c1nc([N+](=O)[O-])cnc1N2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~98%
3,7-dinitro-10H... CAS#:77085-33-7 |
| Literature: Cheeseman; Rishman Tetrahedron, 1980 , vol. 36, # 18 p. 2681 - 2683 |
|
~%
3,7-dinitro-10H... CAS#:77085-33-7 |
| Literature: Cheeseman; Rishman Tetrahedron, 1980 , vol. 36, # 18 p. 2681 - 2683 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-diaza-3,7-dinitrophenothiazine-5-oxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide? |
| A: InChIKey of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide is PADQAUGDLBXWOT-OAQYLSRUSA-N. |
| Q: What is the LogP of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide? |
| A: LogP of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide is 3.56680. |
| Q: What are the upstream materials of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide? |
| A: Related upstream materials(CAS) of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide: 37693-82-6. |
| Q: What is the Chinese name of 77085-33-7? |
| A: Chinese name of 77085-33-7 is 77085-33-7. |
| Q: What is the molecular weight of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide? |
| A: Molecular weight of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide is 307.24200. |
| Q: What is the polar surface area (PSA) of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide? |
| A: Polar surface area (PSA) of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide is 165.73000. |
| Q: What is the molecular formula of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide? |
| A: Molecular formula of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide is C10H5N5O5S. |
| Q: What English synonyms does 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide have? |
| A: English synonyms of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide: 1,4-diaza-3,7-dinitrophenothiazine-5-oxide. |
| Q: What is the boiling point of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide? |
| A: Boiling point of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide is 655.3ºC at 760 mmHg. |
| Q: What is the SMILES notation of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide? |
| A: SMILES notation of 3,7-dinitro-10H-pyrazino[2,3-b][1,4]benzothiazine 5-oxide is O=[N+]([O-])c1ccc2c(c1)S(=O)c1nc([N+](=O)[O-])cnc1N2. |