1,5-difluoro-3-iodo-2-nitro-benzene structure
|
Common Name | 1,5-difluoro-3-iodo-2-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 771-05-1 | Molecular Weight | 284.98700 | |
| Density | 2.162g/cm3 | Boiling Point | 279.1ºC at 760 mmHg | |
| Molecular Formula | C6H2F2INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.6ºC | |
| Name | 1,5-difluoro-3-iodo-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.162g/cm3 |
|---|---|
| Boiling Point | 279.1ºC at 760 mmHg |
| Molecular Formula | C6H2F2INO2 |
| Molecular Weight | 284.98700 |
| Flash Point | 122.6ºC |
| Exact Mass | 284.91000 |
| PSA | 45.82000 |
| LogP | 3.00080 |
| Index of Refraction | 1.61 |
| InChIKey | ZSKLGMYXOHTYOW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(F)cc(F)cc1I |
|
~%
1,5-difluoro-3-... CAS#:771-05-1 |
| Literature: Fletcher,T.L. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 1342 - 1348 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4.6-Difluor-2-iod-1-nitro-benzol |