[Sar9] Substance P
![[Sar9] Substance P Structure](https://image.chemsrc.com/caspic/034/77128-75-7.png)
[Sar9] Substance P structure
|
Common Name | [Sar9] Substance P | ||
|---|---|---|---|---|
| CAS Number | 77128-75-7 | Molecular Weight | 1361.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C64H100N18O13S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of [Sar9] Substance P[Sar9] Substance P is a potent and selective neurokinin (NK)-1 receptor agonist[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | [Sar9] Substance P is a potent and selective neurokinin (NK)-1 receptor agonist[1]. |
|---|---|
| Related Catalog | |
| Target |
Neurokinin (NK)-1 receptor[1] |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C64H100N18O13S |
|---|---|
| Molecular Weight | 1361.66 |
| Exact Mass | 1360.74000 |
| PSA | 533.14000 |
| LogP | 4.14540 |
| InChIKey | CMARLNZAQITWSL-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)C(CC(C)C)NC(=O)CN(C)C(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C(CCC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(N)=O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| WGK Germany | 3 |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| L-Arg-L-Pro-L-Lys-L-Pro-L-Glu(NH2)-L-Glu(NH2)-L-Phe-L-Phe-Sar-L-Leu-L-Met-NH2 |
| L-Arg-L-Pro-L-Lys-L-Pro-L-Gln-L-Gln-L-Phe-L-Phe-Sar-L-Leu-L-Met-NH2 |
| H-Arg-Pro-Lys-Pro-Gln-Gln-Phe-Phe-Sar-Leu-Met-NH2 |
| Substance P,[Sar9] |
| 9-(N-METHYLGLYCINE)SUBSTANCE P) |
| [SAR9]-SUBSTANCE P |
| [Sar9] Substance P |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: Molecular weight of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 is 1361.66. |
| Q: What is the polar surface area (PSA) of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: Polar surface area (PSA) of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 is 533.14000. |
| Q: What is the InChIKey of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: InChIKey of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 is CMARLNZAQITWSL-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: SMILES notation of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 is CSCCC(NC(=O)C(CC(C)C)NC(=O)CN(C)C(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)C(CCC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(N)=O. |
| Q: What is the English name of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: The English name of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 is arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2. |
| Q: What is the LogP of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: LogP of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 is 4.14540. |
| Q: What is the Chinese name of 77128-75-7? |
| A: Chinese name of 77128-75-7 is [Sar9] Substance P. |
| Q: What is the CAS number of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: CAS number of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 is 77128-75-7. |
| Q: What is the molecular formula of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: Molecular formula of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2 is C64H100N18O13S. |
| Q: What are the uses of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2? |
| A: Main uses of arg-pro-lys-pro-gln-gln-phe-phe-sar-leu-met-nh2: [Sar9] Substance P is a potent and selective neurokinin (NK)-1 receptor agonist[1]. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |