N-[4-[(4-Amino-2-fluorophenyl)thio]phenyl]acetamide structure
|
Common Name | N-[4-[(4-Amino-2-fluorophenyl)thio]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 771477-12-4 | Molecular Weight | 276.32900 | |
| Density | 1.31 | Boiling Point | N/A | |
| Molecular Formula | C14H13FN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-(4-amino-2-fluorophenyl)sulfanylphenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31 |
|---|---|
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.32900 |
| Exact Mass | 276.07300 |
| PSA | 83.91000 |
| LogP | 4.74820 |
| InChIKey | BAMQHNRNCNMFTK-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Sc2ccc(N)cc2F)cc1 |
|
~%
N-[4-[(4-Amino-... CAS#:771477-12-4 |
| Literature: Arora, Vishal; Salunkhe, Manikrao M.; Sinha, Neelima; Sinha, Rakesh K.; Jain, Sanjay Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 18 p. 4647 - 4650 |
|
~%
N-[4-[(4-Amino-... CAS#:771477-12-4 |
| Literature: Arora, Vishal; Salunkhe, Manikrao M.; Sinha, Neelima; Sinha, Rakesh K.; Jain, Sanjay Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 18 p. 4647 - 4650 |
|
~%
N-[4-[(4-Amino-... CAS#:771477-12-4 |
| Literature: Arora, Vishal; Salunkhe, Manikrao M.; Sinha, Neelima; Sinha, Rakesh K.; Jain, Sanjay Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 18 p. 4647 - 4650 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-[4-[(4-Amino-2-fluorophenyl)thio]phenyl]acetamide |