1-methyl-2-[(3-methylphenyl)methylsulfanyl]pyridin-1-ium,chloride structure
|
Common Name | 1-methyl-2-[(3-methylphenyl)methylsulfanyl]pyridin-1-ium,chloride | ||
|---|---|---|---|---|
| CAS Number | 77148-85-7 | Molecular Weight | 265.80200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16ClNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-2-[(3-methylphenyl)methylsulfanyl]pyridin-1-ium,chloride |
|---|
| Molecular Formula | C14H16ClNS |
|---|---|
| Molecular Weight | 265.80200 |
| Exact Mass | 265.06900 |
| PSA | 29.18000 |
| LogP | 0.11580 |
| InChIKey | VZIOEBGWHGFREG-UHFFFAOYSA-M |
| SMILES | Cc1cccc(CSc2cccc[n+]2C)c1.[Cl-] |
|
~%
1-methyl-2-[(3-... CAS#:77148-85-7 |
| Literature: John Wyeth and Brother Limited Patent: US4304781 A1, 1981 ; |
|
~47%
1-methyl-2-[(3-... CAS#:77148-85-7 |
| Literature: Beattie; Crossley; Dickinson; Dover European Journal of Medicinal Chemistry, 1983 , vol. 18, # 3 p. 277 - 285 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |