1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide
1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide structure
|
Common Name | 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide | ||
|---|---|---|---|---|
| CAS Number | 77149-03-2 | Molecular Weight | 372.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18BrNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H18BrNS |
|---|---|
| Molecular Weight | 372.32200 |
| Exact Mass | 371.03400 |
| PSA | 29.18000 |
| LogP | 1.31870 |
| InChIKey | UJBLMSMRKUALNJ-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc(CSc2cccc[n+]2Cc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~60%
1-benzyl-2-benz... CAS#:77149-03-2 |
| Literature: Beattie; Crossley; Dickinson; Dover European Journal of Medicinal Chemistry, 1983 , vol. 18, # 3 p. 277 - 285 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: Related upstream materials(CAS) of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide: 51290-79-0;100-39-0. |
| Q: What is the LogP of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: LogP of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide is 1.31870. |
| Q: What is the Chinese name of 77149-03-2? |
| A: Chinese name of 77149-03-2 is 77149-03-2. |
| Q: What is the molecular formula of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: Molecular formula of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide is C19H18BrNS. |
| Q: What is the CAS number of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: CAS number of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide is 77149-03-2. |
| Q: What is the polar surface area (PSA) of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: Polar surface area (PSA) of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide is 29.18000. |
| Q: What is the SMILES notation of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: SMILES notation of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide is [Br-].c1ccc(CSc2cccc[n+]2Cc2ccccc2)cc1. |
| Q: What is the molecular weight of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: Molecular weight of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide is 372.32200. |
| Q: What is the InChIKey of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: InChIKey of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide is UJBLMSMRKUALNJ-UHFFFAOYSA-M. |
| Q: What is the English name of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide? |
| A: The English name of 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide is 1-benzyl-2-benzylsulfanylpyridin-1-ium,bromide. |