3-Quinolinecarboxylicacid, 4-chloro-5,8-dimethoxy-, ethyl ester structure
|
Common Name | 3-Quinolinecarboxylicacid, 4-chloro-5,8-dimethoxy-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 77156-82-2 | Molecular Weight | 295.71800 | |
| Density | 1.279g/cm3 | Boiling Point | 408.4ºC at 760mmHg | |
| Molecular Formula | C14H14ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | ethyl 4-chloro-5,8-dimethoxyquinoline-3-carboxylate |
|---|
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 408.4ºC at 760mmHg |
| Molecular Formula | C14H14ClNO4 |
| Molecular Weight | 295.71800 |
| Flash Point | 200.8ºC |
| Exact Mass | 295.06100 |
| PSA | 57.65000 |
| LogP | 3.08210 |
| Index of Refraction | 1.579 |
| InChIKey | IJDXCOWIANNOTC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2c(OC)ccc(OC)c2c1Cl |
| HS Code | 2933499090 |
|---|
|
~13%
3-Quinolinecarb... CAS#:77156-82-2 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
|
~%
3-Quinolinecarb... CAS#:77156-82-2 |
| Literature: Rauckman; Tidwell; Johnson; Roth Journal of Medicinal Chemistry, 1989 , vol. 32, # 8 p. 1927 - 1935 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |