azidofluorescein structure
|
Common Name | azidofluorescein | ||
|---|---|---|---|---|
| CAS Number | 77162-08-4 | Molecular Weight | 373.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H11N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H11N3O5 |
|---|---|
| Molecular Weight | 373.31800 |
| Exact Mass | 373.07000 |
| PSA | 125.74000 |
| LogP | 4.06036 |
| InChIKey | VHUXAFZEKIMUFX-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
|
~84%
azidofluorescein CAS#:77162-08-4 |
| Literature: Shieh, Peyton; Hangauer, Matthew J.; Bertozzi, Carolyn R. Journal of the American Chemical Society, 2012 , vol. 134, # 42 p. 17428 - 17431 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-azidofluorescein |
| Azidofluorescein |
| N3FSC |