[5-tert-butyl-2-methoxy-3-(sulfanylmethyl)phenyl]methanethiol structure
|
Common Name | [5-tert-butyl-2-methoxy-3-(sulfanylmethyl)phenyl]methanethiol | ||
|---|---|---|---|---|
| CAS Number | 77180-48-4 | Molecular Weight | 256.42700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [5-tert-butyl-2-methoxy-3-(sulfanylmethyl)phenyl]methanethiol |
|---|
| Molecular Formula | C13H20OS2 |
|---|---|
| Molecular Weight | 256.42700 |
| Exact Mass | 256.09600 |
| PSA | 86.83000 |
| LogP | 3.85230 |
| InChIKey | FXPYOAHDGVERHB-UHFFFAOYSA-N |
| SMILES | COc1c(CS)cc(C(C)(C)C)cc1CS |
|
~90%
[5-tert-butyl-2... CAS#:77180-48-4 |
| Literature: Ashram; Miller; Bridson; Georghiou Journal of Organic Chemistry, 1997 , vol. 62, # 19 p. 6476 - 6484 |
|
~%
[5-tert-butyl-2... CAS#:77180-48-4 |
| Literature: Ashram; Miller; Bridson; Georghiou Journal of Organic Chemistry, 1997 , vol. 62, # 19 p. 6476 - 6484 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |