2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E)
Modify Date: 2026-07-31 22:41:18
2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) structure
|
Common Name | 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) | ||
|---|---|---|---|---|
| CAS Number | 77182-83-3 | Molecular Weight | 243.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8Cl2O2 |
|---|---|
| Molecular Weight | 243.08 |
| InChIKey | GIYPWTRVVJKRKN-MFTLUYHJSA-N |
| SMILES | O=C(O)C=CC=Cc1c(Cl)cccc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E)? |
| A: The English name of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) is 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E). |
| Q: What is the CAS number of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E)? |
| A: CAS number of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) is 77182-83-3. |
| Q: What is the molecular weight of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E)? |
| A: Molecular weight of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) is 243.08. |
| Q: What is the Chinese name of 77182-83-3? |
| A: Chinese name of 77182-83-3 is 77182-83-3. |
| Q: What is the InChIKey of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E)? |
| A: InChIKey of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) is GIYPWTRVVJKRKN-MFTLUYHJSA-N. |
| Q: What is the molecular formula of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E)? |
| A: Molecular formula of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) is C11H8Cl2O2. |
| Q: What is the SMILES notation of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E)? |
| A: SMILES notation of 2,4-Pentadienoic acid, 5-(2,6-dichlorophenyl)-, (Z,E) is O=C(O)C=CC=Cc1c(Cl)cccc1Cl. |