Benzene,(cyclopropyldiazomethyl)- (9CI) structure
|
Common Name | Benzene,(cyclopropyldiazomethyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 772-30-5 | Molecular Weight | 158.20000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [cyclopropyl(diazo)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N2 |
|---|---|
| Molecular Weight | 158.20000 |
| Exact Mass | 158.08400 |
| PSA | 37.39000 |
| LogP | 2.19656 |
| InChIKey | YNDZVQSCSZBSOZ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=C(c1ccccc1)C1CC1 |
|
~%
Benzene,(cyclop... CAS#:772-30-5 |
| Literature: Kaufman,G.M. et al. Journal of the American Chemical Society, 1965 , vol. 87, p. 935 - 937 |
| cyclopropylphenyldiazomethane |
| Cyclopropyl-diazo-phenyl-methan |