2,5-Diphenyl-3-(p-diphenyl)tetrazolium chloride structure
|
Common Name | 2,5-Diphenyl-3-(p-diphenyl)tetrazolium chloride | ||
|---|---|---|---|---|
| CAS Number | 77205-78-8 | Molecular Weight | 410.89800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H19ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-Diphenyl-3-(p-diphenyl)tetrazolium chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H19ClN4 |
|---|---|
| Molecular Weight | 410.89800 |
| Exact Mass | 410.13000 |
| PSA | 34.59000 |
| LogP | 1.88200 |
| InChIKey | WQRUUHQSMBWGME-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)[N+]3=NC(=NN3C4=CC=CC=C4)C5=CC=CC=C5.[Cl-] |
| HS Code | 2933990090 |
|---|
|
~%
2,5-Diphenyl-3-... CAS#:77205-78-8 |
| Literature: Ashley et al. Journal of the Chemical Society, 1953 , p. 3881,3885,3886 |
|
~%
2,5-Diphenyl-3-... CAS#:77205-78-8 |
| Literature: Jerchel; Fischer Justus Liebigs Annalen der Chemie, 1949 , vol. 563, p. 200,206 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-DINITROPHENYLHYDRAZINE HYDROCHLORIDE |
| 2-biphenyl-4-yl-3,5-diphenyl-tetrazolium,chloride |
| Diphenyldiphenyltetrazoliumchloride |