[(Z)-octadec-9-enyl] dihydrogen phosphate structure
|
Common Name | [(Z)-octadec-9-enyl] dihydrogen phosphate | ||
|---|---|---|---|---|
| CAS Number | 7722-71-6 | Molecular Weight | 348.45800 | |
| Density | 1.01g/cm3 | Boiling Point | 477.9ºC at 760mmHg | |
| Molecular Formula | C18H37O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.8ºC | |
| Name | [(Z)-octadec-9-enyl] dihydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 477.9ºC at 760mmHg |
| Molecular Formula | C18H37O4P |
| Molecular Weight | 348.45800 |
| Flash Point | 242.8ºC |
| Exact Mass | 348.24300 |
| PSA | 76.57000 |
| LogP | 6.13320 |
| InChIKey | MEESPVWIOBCLJW-KTKRTIGZSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCCOP(=O)(O)O |
| HS Code | 2919900090 |
|---|
|
~99%
[(Z)-octadec-9-... CAS#:7722-71-6 |
| Literature: Sakakura, Akira; Katsukawa, Mikimoto; Ishihara, Kazuaki Angewandte Chemie - International Edition, 2007 , vol. 46, # 9 p. 1423 - 1426 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| phosphoric acid mono-octadec-9c-enyl ester |
| Oleyl dihydrogen phosphate |
| EINECS 231-761-9 |
| monooleyl phosphate |
| oleyl phosphate |
| Monooleylphosphat |