5-(2-bromovinyl)-2'-deoxyuridine-5'-triphosphate structure
|
Common Name | 5-(2-bromovinyl)-2'-deoxyuridine-5'-triphosphate | ||
|---|---|---|---|---|
| CAS Number | 77222-61-8 | Molecular Weight | 573.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16BrN2O14P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-(2-bromovinyl)-2'-deoxyuridine-5'-triphosphateBVDU 5′-Triphosphate is an antivirus agent with 5′-Triphosphate label, targeting viral DNA polymerase. BVDU 5′-Triphosphate shows excellent selectivity against varicella-zoster virus (VZV) and herpes simplex virus type 1 (HSV-1), due to a specific phosphorylation by the virus-encoded thymidine kinase. |
| Name | [[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Description | BVDU 5′-Triphosphate is an antivirus agent with 5′-Triphosphate label, targeting viral DNA polymerase. BVDU 5′-Triphosphate shows excellent selectivity against varicella-zoster virus (VZV) and herpes simplex virus type 1 (HSV-1), due to a specific phosphorylation by the virus-encoded thymidine kinase. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H16BrN2O14P3 |
|---|---|
| Molecular Weight | 573.08 |
| Exact Mass | 571.90000 |
| PSA | 273.83000 |
| LogP | 0.30620 |
| InChIKey | BDKFDDMJXWAXHI-PIXDULNESA-N |
| SMILES | O=c1[nH]c(=O)n(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)cc1C=CBr |
| BVdUTP |
| E-5-Bromovinyl-2'-deoxyuridine triphosphate |