2,4-dinitrobenzenediazonium,chloride
2,4-dinitrobenzenediazonium,chloride structure
|
Common Name | 2,4-dinitrobenzenediazonium,chloride | ||
|---|---|---|---|---|
| CAS Number | 77232-70-3 | Molecular Weight | 230.56500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3ClN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dinitrobenzenediazonium,chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H3ClN4O4 |
|---|---|
| Molecular Weight | 230.56500 |
| Exact Mass | 229.98400 |
| PSA | 119.79000 |
| LogP | 0.03798 |
| InChIKey | WDUWMMQCLJVHMV-UHFFFAOYSA-M |
| SMILES | N#[N+]c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].[Cl-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4-dinitrobenz... CAS#:77232-70-3 |
| Literature: Niziol, Jacek; Pielichowski, Jan; Gondek, Ewa Molecular Crystals and Liquid Crystals, 2010 , vol. 522, p. 249 - 254 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 3 | |
CAS#:97-00-7
CAS#:1656-44-6
CAS#:67516-66-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-Dinitro-benzoldiazonium,Chlorid |
| 2,4-dinitro benzene diazonium chloride |
| Benzenediazonium,2,4-dinitro-,chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,4-dinitrobenzenediazonium,chloride? |
| A: Molecular weight of 2,4-dinitrobenzenediazonium,chloride is 230.56500. |
| Q: What English synonyms does 2,4-dinitrobenzenediazonium,chloride have? |
| A: English synonyms of 2,4-dinitrobenzenediazonium,chloride: 2,4-Dinitro-benzoldiazonium,Chlorid, 2,4-dinitro benzene diazonium chloride, Benzenediazonium,2,4-dinitro-,chloride. |
| Q: What is the molecular formula of 2,4-dinitrobenzenediazonium,chloride? |
| A: Molecular formula of 2,4-dinitrobenzenediazonium,chloride is C6H3ClN4O4. |
| Q: What is the polar surface area (PSA) of 2,4-dinitrobenzenediazonium,chloride? |
| A: Polar surface area (PSA) of 2,4-dinitrobenzenediazonium,chloride is 119.79000. |
| Q: What are the downstream products of 2,4-dinitrobenzenediazonium,chloride? |
| A: Related downstream products(CAS) of 2,4-dinitrobenzenediazonium,chloride: 97-00-7;1656-44-6;67516-66-9. |
| Q: What is the SMILES notation of 2,4-dinitrobenzenediazonium,chloride? |
| A: SMILES notation of 2,4-dinitrobenzenediazonium,chloride is N#[N+]c1ccc([N+](=O)[O-])cc1[N+](=O)[O-].[Cl-]. |
| Q: What is the English name of 2,4-dinitrobenzenediazonium,chloride? |
| A: The English name of 2,4-dinitrobenzenediazonium,chloride is 2,4-dinitrobenzenediazonium,chloride. |
| Q: What is the LogP of 2,4-dinitrobenzenediazonium,chloride? |
| A: LogP of 2,4-dinitrobenzenediazonium,chloride is 0.03798. |
| Q: What is the InChIKey of 2,4-dinitrobenzenediazonium,chloride? |
| A: InChIKey of 2,4-dinitrobenzenediazonium,chloride is WDUWMMQCLJVHMV-UHFFFAOYSA-M. |
| Q: What is the Chinese name of 77232-70-3? |
| A: Chinese name of 77232-70-3 is 77232-70-3. |