2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide
2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide structure
|
Common Name | 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 77236-79-4 | Molecular Weight | 232.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N2O2 |
|---|---|
| Molecular Weight | 232.27800 |
| Exact Mass | 232.12100 |
| PSA | 50.92000 |
| LogP | 3.34780 |
| InChIKey | OSLOYVPFKCGCTJ-UHFFFAOYSA-N |
| SMILES | CCCCc1c(C)n([O-])c2ccccc2[n+]1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
2-butyl-3-methy... CAS#:77236-79-4 |
| Literature: Heyns, Kurt; Behse, Ernst; Francke, Wittko Chemische Berichte, 1981 , vol. 114, # 1 p. 240 - 245 |
|
~%
2-butyl-3-methy... CAS#:77236-79-4 |
| Literature: Heyns, Kurt; Behse, Ernst; Francke, Wittko Chemische Berichte, 1981 , vol. 114, # 1 p. 240 - 245 |
|
~%
2-butyl-3-methy... CAS#:77236-79-4 |
| Literature: Sun, Tao; Zhao, Wen-Jing; Hao, Ai-You; Sun, Li-Zhen Synthetic Communications, 2011 , vol. 41, # 20 p. 3097 - 3105 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Butyl-3-methylchinoxalin-1,4-dioxiod |
| Quinoxaline,2-butyl-3-methyl-,1,4-dioxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: LogP of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide is 3.34780. |
| Q: What are the upstream materials of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: Related upstream materials(CAS) of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide: 480-96-6;110-43-0;88-74-4;1322877-87-1. |
| Q: What is the molecular weight of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: Molecular weight of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide is 232.27800. |
| Q: What is the polar surface area (PSA) of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: Polar surface area (PSA) of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide is 50.92000. |
| Q: What is the CAS number of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: CAS number of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide is 77236-79-4. |
| Q: What is the molecular formula of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: Molecular formula of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide is C13H16N2O2. |
| Q: What is the InChIKey of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: InChIKey of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide is OSLOYVPFKCGCTJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: SMILES notation of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide is CCCCc1c(C)n([O-])c2ccccc2[n+]1=O. |
| Q: What is the English name of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide? |
| A: The English name of 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide is 2-butyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide. |
| Q: What is the Chinese name of 77236-79-4? |
| A: Chinese name of 77236-79-4 is 77236-79-4. |