13-oxoellipticine
Modify Date: 2025-12-02 10:34:04
13-oxoellipticine structure
|
Common Name | 13-oxoellipticine | ||
|---|---|---|---|---|
| CAS Number | 77251-57-1 | Molecular Weight | 260.29000 | |
| Density | 1.36g/cm3 | Boiling Point | 547.4ºC at 760 mmHg | |
| Molecular Formula | C17H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.9ºC | |
| Name | 11-methyl-6H-pyrido[4,3-b]carbazole-5-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 547.4ºC at 760 mmHg |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.29000 |
| Flash Point | 276.9ºC |
| Exact Mass | 260.09500 |
| PSA | 45.75000 |
| LogP | 3.99020 |
| Index of Refraction | 1.828 |
| InChIKey | GEGSTIQXXZRQTO-UHFFFAOYSA-N |
| SMILES | Cc1c2cnccc2c(C=O)c2[nH]c3ccccc3c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 13-Oxoellipticine |
| oxo-17 ellipiticine |
| 17-Oxoellipticine |
| 11-methyl-6H-pyrido<4,3-b>carbazole-5-carbaldehyde |