1,5-DIISOPROPYL-2,4-DINITRO-BENZENE structure
|
Common Name | 1,5-DIISOPROPYL-2,4-DINITRO-BENZENE | ||
|---|---|---|---|---|
| CAS Number | 77256-78-1 | Molecular Weight | 252.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-dinitro-2,4-di(propan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16N2O4 |
|---|---|
| Molecular Weight | 252.26600 |
| Exact Mass | 252.11100 |
| PSA | 91.64000 |
| LogP | 4.79620 |
| InChIKey | SYRVNCAMWDHLKB-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2904209090 |
|---|
|
~65%
1,5-DIISOPROPYL... CAS#:77256-78-1 |
| Literature: Beak, Peter; Carter, Linda G. Journal of Organic Chemistry, 1981 , vol. 46, # 11 p. 2363 - 2373 |
|
~%
1,5-DIISOPROPYL... CAS#:77256-78-1 |
| Literature: Newton Journal of the American Chemical Society, 1943 , vol. 65, p. 2444 |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,3-diisopropyl-4,6-dinitrobenzene |
| 1,5-diisopropyl-2,4-dinitrobenzene |
| 1,5-Diisopropyl-2,4-dinitro-benzol |