2-Methyl-3-[(3,4-methylenedioxy)phenyl]propionic acid
Modify Date: 2025-08-22 08:57:36
![2-Methyl-3-[(3,4-methylenedioxy)phenyl]propionic acid Structure](https://image.chemsrc.com/caspic/111/77269-66-0.png)
2-Methyl-3-[(3,4-methylenedioxy)phenyl]propionic acid structure
|
Common Name | 2-Methyl-3-[(3,4-methylenedioxy)phenyl]propionic acid | ||
|---|---|---|---|---|
| CAS Number | 77269-66-0 | Molecular Weight | 208.21100 | |
| Density | 1.29g/cm3 | Boiling Point | 351.142ºC at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.452ºC | |
| Name | 2-Methyl-3-[(3,4-methylenedioxy)phenyl]propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 351.142ºC at 760 mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 138.452ºC |
| Exact Mass | 208.07400 |
| PSA | 55.76000 |
| LogP | 1.67850 |
| Index of Refraction | 1.567 |
| InChIKey | DBXAHUCZEXVUKS-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccc2c(c1)OCO2)C(=O)O |
| HS Code | 2932999099 |
|---|
|
~85%
2-Methyl-3-[(3,... CAS#:77269-66-0 |
| Literature: Schulze, Matthias Synthetic Communications, 2010 , vol. 40, # 10 p. 1461 - 1476 |
|
~94%
2-Methyl-3-[(3,... CAS#:77269-66-0 |
| Literature: Schulze, Matthias Synthetic Communications, 2010 , vol. 40, # 10 p. 1461 - 1476 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD06203229 |
| 3-(1,3-benzodioxol-5-yl)-2-methylpropanoic acid |