1,4-Acridinedione, 3-bromo-2-methoxy- structure
|
Common Name | 1,4-Acridinedione, 3-bromo-2-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 77282-37-2 | Molecular Weight | 318.12200 | |
| Density | 1.7g/cm3 | Boiling Point | 467.2ºC at 760 mmHg | |
| Molecular Formula | C14H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.3ºC | |
| Name | 3-bromo-2-methoxyacridine-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 467.2ºC at 760 mmHg |
| Molecular Formula | C14H8BrNO3 |
| Molecular Weight | 318.12200 |
| Flash Point | 236.3ºC |
| Exact Mass | 316.96900 |
| PSA | 56.26000 |
| LogP | 2.86670 |
| Index of Refraction | 1.703 |
| InChIKey | VBSQGPMTEQVKDH-UHFFFAOYSA-N |
| SMILES | COC1=C(Br)C(=O)c2nc3ccccc3cc2C1=O |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-Acridinedione,3-bromo-2-methoxy |
| 3-Bromo-2-methoxy-1,4-acridinedione |
| bromo-3 methoxy-2 acridinedione-1,4 |