6-hex-5-en-2-yl-1,5-dimethoxycyclohexa-1,4-diene structure
|
Common Name | 6-hex-5-en-2-yl-1,5-dimethoxycyclohexa-1,4-diene | ||
|---|---|---|---|---|
| CAS Number | 77283-86-4 | Molecular Weight | 222.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-hex-5-en-2-yl-1,5-dimethoxycyclohexa-1,4-diene |
|---|
| Molecular Formula | C14H22O2 |
|---|---|
| Molecular Weight | 222.32300 |
| Exact Mass | 222.16200 |
| PSA | 18.46000 |
| LogP | 3.66920 |
| InChIKey | PTDCTTDGGLYOPK-UHFFFAOYSA-N |
| SMILES | C=CCCC(C)C1C(OC)=CCC=C1OC |
|
~%
6-hex-5-en-2-yl... CAS#:77283-86-4 |
| Literature: Birch, Alan M.; Pattenden, Gerald Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1913 - 1917 |
|
~%
6-hex-5-en-2-yl... CAS#:77283-86-4 |
| Literature: Birch, Alan M.; Pattenden, Gerald Journal of the Chemical Society, Chemical Communications, 1980 , # 24 p. 1195 - 1197 |