3-(4-methoxyphenyl)-4-methyl-1,3-thiazole-2-thione structure
|
Common Name | 3-(4-methoxyphenyl)-4-methyl-1,3-thiazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 77293-28-8 | Molecular Weight | 237.34100 | |
| Density | 1.33g/cm3 | Boiling Point | 372.3ºC at 760 mmHg | |
| Molecular Formula | C11H11NOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179ºC | |
| Name | 3-(4-methoxyphenyl)-4-methyl-1,3-thiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760 mmHg |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.34100 |
| Flash Point | 179ºC |
| Exact Mass | 237.02800 |
| PSA | 74.49000 |
| LogP | 3.58530 |
| Index of Refraction | 1.691 |
| InChIKey | GKHYAVHPLQCNNM-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2c(C)csc2=S)cc1 |
|
~%
3-(4-methoxyphe... CAS#:77293-28-8 |
| Literature: Dash, Manjula; Pattnayak, J.; Nath, J. P.; Mahapatra, G. N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 10 p. 918 - 920 |
|
~%
3-(4-methoxyphe... CAS#:77293-28-8 |
| Literature: Huenig,S.; Lampe,W. Justus Liebigs Annalen der Chemie, 1961 , vol. 647, p. 66 - 76 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hms2372o20 |