Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate
Modify Date: 2025-08-28 12:26:50
Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate structure
|
Common Name | Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate | ||
|---|---|---|---|---|
| CAS Number | 77303-65-2 | Molecular Weight | 310.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H26O8 |
|---|---|
| Molecular Weight | 310.34 |
| InChIKey | BAAUJSUOMGYSFP-UHFFFAOYSA-N |
| SMILES | COC(=O)COCCOCCOCCOCCOCCO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate? |
| A: SMILES notation of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate is COC(=O)COCCOCCOCCOCCOCCO. |
| Q: What is the CAS number of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate? |
| A: CAS number of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate is 77303-65-2. |
| Q: What is the Chinese name of 77303-65-2? |
| A: Chinese name of 77303-65-2 is 77303-65-2. |
| Q: What is the molecular formula of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate? |
| A: Molecular formula of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate is C13H26O8. |
| Q: What is the English name of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate? |
| A: The English name of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate is Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate. |
| Q: What is the InChIKey of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate? |
| A: InChIKey of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate is BAAUJSUOMGYSFP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate? |
| A: Molecular weight of Methyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadecanoate is 310.34. |