12H-Benzo[a]phenothiazine, 12-acetyl-2-(chloroacetyl)- structure
|
Common Name | 12H-Benzo[a]phenothiazine, 12-acetyl-2-(chloroacetyl)- | ||
|---|---|---|---|---|
| CAS Number | 7731-97-7 | Molecular Weight | 367.84900 | |
| Density | 1.388g/cm3 | Boiling Point | 639.9ºC at 760 mmHg | |
| Molecular Formula | C20H14ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.8ºC | |
| Name | 1-(12-acetylbenzo[a]phenothiazin-2-yl)-2-chloroethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 639.9ºC at 760 mmHg |
| Molecular Formula | C20H14ClNO2S |
| Molecular Weight | 367.84900 |
| Flash Point | 340.8ºC |
| Exact Mass | 367.04300 |
| PSA | 62.68000 |
| LogP | 5.47550 |
| Index of Refraction | 1.704 |
| InChIKey | UMTVLBHRIIZPNY-UHFFFAOYSA-N |
| SMILES | CC(=O)N1c2ccccc2Sc2ccc3ccc(C(=O)CCl)cc3c21 |
|
~%
12H-Benzo[a]phe... CAS#:7731-97-7 |
| Literature: Jackson; Shirley The Journal of organic chemistry, 1967 , vol. 32, # 4 p. 1190 - 1194 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-chloracetyl-12H-acetylbenzo<a>phenothiazine |
| 2-Chloracetyl-12-acetyl-benzo<a>phenothiazin |