Ethyl 3-bromo-5-chloro-2-hydroxybenzoate structure
|
Common Name | Ethyl 3-bromo-5-chloro-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 773134-85-3 | Molecular Weight | 279.515 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 293.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H8BrClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.3±25.9 °C | |
| Name | ethyl 3-bromo-5-chloro-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.6±35.0 °C at 760 mmHg |
| Molecular Formula | C9H8BrClO3 |
| Molecular Weight | 279.515 |
| Flash Point | 131.3±25.9 °C |
| Exact Mass | 277.934540 |
| PSA | 46.53000 |
| LogP | 4.62 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | IVFSJEZMMQQJFK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Cl)cc(Br)c1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 3-bromo-5-chloro-2-hydroxy-, ethyl ester |
| Ethyl 3-bromo-5-chloro-2-hydroxybenzoate |