Ethyl 5-bromo-2,4-dimethoxybenzoate
Modify Date: 2025-09-01 17:23:53
Ethyl 5-bromo-2,4-dimethoxybenzoate structure
|
Common Name | Ethyl 5-bromo-2,4-dimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 773136-05-3 | Molecular Weight | 289.12300 | |
| Density | 1.39g/cm3 | Boiling Point | 362.126ºC at 760 mmHg | |
| Molecular Formula | C11H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.808ºC | |
| Name | Ethyl 5-bromo-2,4-dimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 362.126ºC at 760 mmHg |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.12300 |
| Flash Point | 172.808ºC |
| Exact Mass | 288.00000 |
| PSA | 44.76000 |
| LogP | 2.64300 |
| Index of Refraction | 1.525 |
| InChIKey | WETAVQWGCDQCQJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Br)c(OC)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 5-bromanyl-2,4-dimethoxy-benzoate |