ethyl 5-bromo-2-hydroxy-3-nitrobenzoate structure
|
Common Name | ethyl 5-bromo-2-hydroxy-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 773136-20-2 | Molecular Weight | 290.06800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-bromo-2-hydroxy-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8BrNO5 |
|---|---|
| Molecular Weight | 290.06800 |
| Exact Mass | 288.95900 |
| PSA | 92.35000 |
| LogP | 2.76280 |
| InChIKey | SNQAPIZRHVIGJD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Br)cc([N+](=O)[O-])c1O |
| HS Code | 2918290000 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 5-bromo-2-hydroxy-3-nitrobenzoic acid ethyl ester |