2-((methoxycarbonyl)amino)-3-phenylpropanoic acid
2-((methoxycarbonyl)amino)-3-phenylpropanoic acid structure
|
Common Name | 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 77357-58-5 | Molecular Weight | 223.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13NO4 |
|---|---|
| Molecular Weight | 223.22500 |
| Exact Mass | 223.08400 |
| PSA | 75.63000 |
| LogP | 1.42920 |
| InChIKey | QGICDLYPUUZBIV-UHFFFAOYSA-N |
| SMILES | COC(=O)NC(Cc1ccccc1)C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:150-30-1
CAS#:136354-01-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-methoxycarbonylphenylalanine |
| N-Methoxycarbonyl-phenylalanin |
| α-Carbomethoxyamino-β-phenyl-propionsaeure |
| N-methoxycarbonyl-phenylalanine |
| Carbomethoxy-dl-phenylalanin |
| α-Carbomethoxyamino-hydrozimtsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 77357-58-5? |
| A: Chinese name of 77357-58-5 is 77357-58-5. |
| Q: What is the CAS number of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid? |
| A: CAS number of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid is 77357-58-5. |
| Q: What English synonyms does 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid have? |
| A: English synonyms of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid: N-methoxycarbonylphenylalanine, N-Methoxycarbonyl-phenylalanin, α-Carbomethoxyamino-β-phenyl-propionsaeure, N-methoxycarbonyl-phenylalanine, Carbomethoxy-dl-phenylalanin, α-Carbomethoxyamino-hydrozimtsaeure. |
| Q: What is the molecular formula of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid? |
| A: Molecular formula of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid is C11H13NO4. |
| Q: What is the polar surface area (PSA) of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid? |
| A: Polar surface area (PSA) of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid is 75.63000. |
| Q: What is the SMILES notation of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid? |
| A: SMILES notation of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid is COC(=O)NC(Cc1ccccc1)C(=O)O. |
| Q: What is the InChIKey of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid? |
| A: InChIKey of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid is QGICDLYPUUZBIV-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid? |
| A: Molecular weight of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid is 223.22500. |
| Q: What is the English name of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid? |
| A: The English name of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid is 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid. |
| Q: What is the LogP of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid? |
| A: LogP of 2-((methoxycarbonyl)amino)-3-phenylpropanoic acid is 1.42920. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |