N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide
Modify Date: 2026-09-22 08:54:16
N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide structure
|
Common Name | N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide | ||
|---|---|---|---|---|
| CAS Number | 77357-64-3 | Molecular Weight | 229.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14F3NO3 |
|---|---|
| Molecular Weight | 229.20 |
| InChIKey | BFEIKGPVCYOETP-UHFFFAOYSA-N |
| SMILES | COC(CCCNC(=O)C(F)(F)F)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide? |
| A: The English name of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide is N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide. |
| Q: What is the SMILES notation of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide? |
| A: SMILES notation of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide is COC(CCCNC(=O)C(F)(F)F)OC. |
| Q: What is the molecular formula of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide? |
| A: Molecular formula of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide is C8H14F3NO3. |
| Q: What is the molecular weight of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide? |
| A: Molecular weight of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide is 229.20. |
| Q: What is the Chinese name of 77357-64-3? |
| A: Chinese name of 77357-64-3 is 77357-64-3. |
| Q: What is the InChIKey of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide? |
| A: InChIKey of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide is BFEIKGPVCYOETP-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide? |
| A: CAS number of N-(4,4-Dimethoxybutyl)-2,2,2-trifluoroacetamide is 77357-64-3. |