3-methyl-1,2,3-butanetricarboxylic acid
3-methyl-1,2,3-butanetricarboxylic acid structure
|
Common Name | 3-methyl-1,2,3-butanetricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 77370-41-3 | Molecular Weight | 204.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-1,2,3-butanetricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12O6 |
|---|---|
| Molecular Weight | 204.17700 |
| Exact Mass | 204.06300 |
| PSA | 111.90000 |
| LogP | 0.27270 |
| InChIKey | VMWJGTKDJFMTFZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)C(CC(=O)O)C(=O)O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| γ-Methyl-butan-α.β.γ-tricarbonsaeure |
| 3-Methyl-butan-1,2,3-tricarbonsaeure |
| α.α'-Dimethyl-α-carboxy-glutarsaeure |
| 3-Methylbutane-1,2,3-tricarboxylic Acid |
| 3-methyl-butane-1,2,3-tricarboxylic acid |
| 3-methylbutane-1,2,3-tricarboxylic acid |
| α.α-Dimethyl-tricarballylsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-methyl-1,2,3-butanetricarboxylic acid? |
| A: LogP of 3-methyl-1,2,3-butanetricarboxylic acid is 0.27270. |
| Q: What is the molecular weight of 3-methyl-1,2,3-butanetricarboxylic acid? |
| A: Molecular weight of 3-methyl-1,2,3-butanetricarboxylic acid is 204.17700. |
| Q: What is the Chinese name of 77370-41-3? |
| A: Chinese name of 77370-41-3 is 77370-41-3. |
| Q: What is the SMILES notation of 3-methyl-1,2,3-butanetricarboxylic acid? |
| A: SMILES notation of 3-methyl-1,2,3-butanetricarboxylic acid is CC(C)(C(=O)O)C(CC(=O)O)C(=O)O. |
| Q: What is the CAS number of 3-methyl-1,2,3-butanetricarboxylic acid? |
| A: CAS number of 3-methyl-1,2,3-butanetricarboxylic acid is 77370-41-3. |
| Q: What is the English name of 3-methyl-1,2,3-butanetricarboxylic acid? |
| A: The English name of 3-methyl-1,2,3-butanetricarboxylic acid is 3-methyl-1,2,3-butanetricarboxylic acid. |
| Q: What is the molecular formula of 3-methyl-1,2,3-butanetricarboxylic acid? |
| A: Molecular formula of 3-methyl-1,2,3-butanetricarboxylic acid is C8H12O6. |
| Q: What is the InChIKey of 3-methyl-1,2,3-butanetricarboxylic acid? |
| A: InChIKey of 3-methyl-1,2,3-butanetricarboxylic acid is VMWJGTKDJFMTFZ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-methyl-1,2,3-butanetricarboxylic acid? |
| A: Polar surface area (PSA) of 3-methyl-1,2,3-butanetricarboxylic acid is 111.90000. |
| Q: What English synonyms does 3-methyl-1,2,3-butanetricarboxylic acid have? |
| A: English synonyms of 3-methyl-1,2,3-butanetricarboxylic acid: γ-Methyl-butan-α.β.γ-tricarbonsaeure, 3-Methyl-butan-1,2,3-tricarbonsaeure, α.α'-Dimethyl-α-carboxy-glutarsaeure, 3-Methylbutane-1,2,3-tricarboxylic Acid, 3-methyl-butane-1,2,3-tricarboxylic acid, 3-methylbutane-1,2,3-tricarboxylic acid, α.α-Dimethyl-tricarballylsaeure. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |