Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol
Modify Date: 2026-09-23 13:09:57
![Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol Structure](https://www.chemsrc.com/extcaspic/170/77377-09-4.png)
Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol structure
|
Common Name | Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol | ||
|---|---|---|---|---|
| CAS Number | 77377-09-4 | Molecular Weight | 192.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12O3 |
|---|---|
| Molecular Weight | 192.21 |
| InChIKey | LSRNDLVWXGANRZ-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)OC1(CCCC1)O2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol? |
| A: SMILES notation of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol is Oc1ccc2c(c1)OC1(CCCC1)O2. |
| Q: What is the InChIKey of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol? |
| A: InChIKey of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol is LSRNDLVWXGANRZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 77377-09-4? |
| A: Chinese name of 77377-09-4 is 77377-09-4. |
| Q: What is the molecular weight of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol? |
| A: Molecular weight of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol is 192.21. |
| Q: What is the English name of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol? |
| A: The English name of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol is Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol. |
| Q: What is the CAS number of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol? |
| A: CAS number of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol is 77377-09-4. |
| Q: What is the molecular formula of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol? |
| A: Molecular formula of Spiro[1,3-benzodioxole-2,1'-cyclopentane]-6-ol is C11H12O3. |