4,6-dioctoxybenzene-1,3-dicarbonyl chloride structure
|
Common Name | 4,6-dioctoxybenzene-1,3-dicarbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 773866-24-3 | Molecular Weight | 459.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H36Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-dioctoxybenzene-1,3-dicarbonyl chloride |
|---|
| Molecular Formula | C24H36Cl2O4 |
|---|---|
| Molecular Weight | 459.44600 |
| Exact Mass | 458.19900 |
| PSA | 52.60000 |
| LogP | 7.92320 |
| InChIKey | LRRNQCMXRICJBS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1cc(OCCCCCCCC)c(C(=O)Cl)cc1C(=O)Cl |
|
~%
4,6-dioctoxyben... CAS#:773866-24-3 |
| Literature: Yuan, Lihua; Feng, Wen; Yamato, Kazuhiro; Sanford, Adam R.; Xu, Dingguo; Guo, Hua; Gong, Bing Journal of the American Chemical Society, 2004 , vol. 126, # 36 p. 11120 - 11121 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |