1,2-bis[4-(1,1-dimethylethyl)phenyl]-2-hydroxyethan-1-one structure
|
Common Name | 1,2-bis[4-(1,1-dimethylethyl)phenyl]-2-hydroxyethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 77387-64-5 | Molecular Weight | 324.45700 | |
| Density | 1.035g/cm3 | Boiling Point | 456.9ºC at 760 mmHg | |
| Molecular Formula | C22H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5ºC | |
| Name | 1,2-bis(4-tert-butylphenyl)-2-hydroxyethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.035g/cm3 |
|---|---|
| Boiling Point | 456.9ºC at 760 mmHg |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.45700 |
| Flash Point | 194.5ºC |
| Exact Mass | 324.20900 |
| PSA | 37.30000 |
| LogP | 5.19790 |
| Index of Refraction | 1.545 |
| InChIKey | RPEDYDVPZFYPOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)C(O)c2ccc(C(C)(C)C)cc2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2914400090 |
|---|
|
~85%
1,2-bis[4-(1,1-... CAS#:77387-64-5 |
| Literature: Liu, Yongjun; Wang, Hui; Fu, Yulong; Qi, Yan; Yang, Kuiwei Synthetic Communications, 2014 , vol. 44, # 2 p. 259 - 266 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4,4'-Di-tert-butylbenzoin |
| p,p'-Di-t-Butyl-benzoin |